C27H32N4O2 — CID 53102246
azepan-1-yl-[1-[4-(4-methoxyphenyl)piperazin-1-yl]isoquinolin-7-yl]methanone (PubChem CID 53102246) has the molecular formula C27H32N4O2 and a molecular weight of 444.58 g/mol. Its IUPAC name is azepan-1-yl-[1-[4-(4-methoxyphenyl)piperazin-1-yl]isoquinolin-7-yl]methanone.
| Compound Name | azepan-1-yl-[1-[4-(4-methoxyphenyl)piperazin-1-yl]isoquinolin-7-yl]methanone |
|---|---|
| PubChem CID | 53102246 |
| Molecular Formula | C27H32N4O2 |
| Molecular Weight | 444.58 g/mol |
| Exact Mass | 444.25 |
| IUPAC Name | azepan-1-yl-[1-[4-(4-methoxyphenyl)piperazin-1-yl]isoquinolin-7-yl]methanone |
| SMILES | COc1ccc(N2CCN(c3nccc4ccc(C(=O)N5CCCCCC5)cc34)CC2)cc1 |
| InChI | InChI=1S/C27H32N4O2/c1-33-24-10-8-23(9-11-24)29-16-18-30(19-17-29)26-25-20-22(7-6-21(25)12-13-28-26)27(32)31-14-4-2-3-5-15-31/h6-13,20H,2-5,14-19H2,1H3 |
| InChIKey | WDUKCDRYMGZFFC-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 48.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.58 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|