C25H23ClN4O2 — CID 53102297
1-[4-(4-chlorophenyl)piperazin-1-yl]-N-(furan-2-ylmethyl)isoquinoline-7-carboxamide (PubChem CID 53102297) has the molecular formula C25H23ClN4O2 and a molecular weight of 446.94 g/mol. Its IUPAC name is 1-[4-(4-chlorophenyl)piperazin-1-yl]-N-(furan-2-ylmethyl)isoquinoline-7-carboxamide.
| Compound Name | 1-[4-(4-chlorophenyl)piperazin-1-yl]-N-(furan-2-ylmethyl)isoquinoline-7-carboxamide |
|---|---|
| PubChem CID | 53102297 |
| Molecular Formula | C25H23ClN4O2 |
| Molecular Weight | 446.94 g/mol |
| Exact Mass | 446.15 |
| IUPAC Name | 1-[4-(4-chlorophenyl)piperazin-1-yl]-N-(furan-2-ylmethyl)isoquinoline-7-carboxamide |
| SMILES | O=C(NCc1ccco1)c1ccc2ccnc(N3CCN(c4ccc(Cl)cc4)CC3)c2c1 |
| InChI | InChI=1S/C25H23ClN4O2/c26-20-5-7-21(8-6-20)29-11-13-30(14-12-29)24-23-16-19(4-3-18(23)9-10-27-24)25(31)28-17-22-2-1-15-32-22/h1-10,15-16H,11-14,17H2,(H,28,31) |
| InChIKey | RMSLAIYFWRVEPG-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 61.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.94 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |