C19H13ClN2O3 — CID 22575714
3-(4-chlorophenyl)-N-(furan-2-ylmethyl)-2,1-benzoxazole-5-carboxamide (PubChem CID 22575714) has the molecular formula C19H13ClN2O3 and a molecular weight of 352.78 g/mol. Its IUPAC name is 3-(4-chlorophenyl)-N-(furan-2-ylmethyl)-2,1-benzoxazole-5-carboxamide.
| Compound Name | 3-(4-chlorophenyl)-N-(furan-2-ylmethyl)-2,1-benzoxazole-5-carboxamide |
|---|---|
| PubChem CID | 22575714 |
| Molecular Formula | C19H13ClN2O3 |
| Molecular Weight | 352.78 g/mol |
| Exact Mass | 352.06 |
| IUPAC Name | 3-(4-chlorophenyl)-N-(furan-2-ylmethyl)-2,1-benzoxazole-5-carboxamide |
| SMILES | O=C(NCc1ccco1)c1ccc2noc(-c3ccc(Cl)cc3)c2c1 |
| InChI | InChI=1S/C19H13ClN2O3/c20-14-6-3-12(4-7-14)18-16-10-13(5-8-17(16)22-25-18)19(23)21-11-15-2-1-9-24-15/h1-10H,11H2,(H,21,23) |
| InChIKey | JCUTYSGULGLZET-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 68.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.78 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |