C27H32FN5O2 — CID 53102384
1-[4-(2-fluorophenyl)piperazin-1-yl]-N-(3-morpholin-4-ylpropyl)isoquinoline-7-carboxamide (PubChem CID 53102384) has the molecular formula C27H32FN5O2 and a molecular weight of 477.58 g/mol. Its IUPAC name is 1-[4-(2-fluorophenyl)piperazin-1-yl]-N-(3-morpholin-4-ylpropyl)isoquinoline-7-carboxamide.
| Compound Name | 1-[4-(2-fluorophenyl)piperazin-1-yl]-N-(3-morpholin-4-ylpropyl)isoquinoline-7-carboxamide |
|---|---|
| PubChem CID | 53102384 |
| Molecular Formula | C27H32FN5O2 |
| Molecular Weight | 477.58 g/mol |
| Exact Mass | 477.25 |
| IUPAC Name | 1-[4-(2-fluorophenyl)piperazin-1-yl]-N-(3-morpholin-4-ylpropyl)isoquinoline-7-carboxamide |
| SMILES | O=C(NCCCN1CCOCC1)c1ccc2ccnc(N3CCN(c4ccccc4F)CC3)c2c1 |
| InChI | InChI=1S/C27H32FN5O2/c28-24-4-1-2-5-25(24)32-12-14-33(15-13-32)26-23-20-22(7-6-21(23)8-10-29-26)27(34)30-9-3-11-31-16-18-35-19-17-31/h1-2,4-8,10,20H,3,9,11-19H2,(H,30,34) |
| InChIKey | IHXDINNHZFXJEC-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 60.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.58 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|