C28H28FN5O — CID 50798110
N-[3-[4-(2-fluorophenyl)piperazin-1-yl]propyl]-2-pyridin-2-ylquinoline-4-carboxamide (PubChem CID 50798110) has the molecular formula C28H28FN5O and a molecular weight of 469.56 g/mol. Its IUPAC name is N-[3-[4-(2-fluorophenyl)piperazin-1-yl]propyl]-2-pyridin-2-ylquinoline-4-carboxamide.
| Compound Name | N-[3-[4-(2-fluorophenyl)piperazin-1-yl]propyl]-2-pyridin-2-ylquinoline-4-carboxamide |
|---|---|
| PubChem CID | 50798110 |
| Molecular Formula | C28H28FN5O |
| Molecular Weight | 469.56 g/mol |
| Exact Mass | 469.23 |
| IUPAC Name | N-[3-[4-(2-fluorophenyl)piperazin-1-yl]propyl]-2-pyridin-2-ylquinoline-4-carboxamide |
| SMILES | O=C(NCCCN1CCN(c2ccccc2F)CC1)c1cc(-c2ccccn2)nc2ccccc12 |
| InChI | InChI=1S/C28H28FN5O/c29-23-9-2-4-12-27(23)34-18-16-33(17-19-34)15-7-14-31-28(35)22-20-26(25-11-5-6-13-30-25)32-24-10-3-1-8-21(22)24/h1-6,8-13,20H,7,14-19H2,(H,31,35) |
| InChIKey | KDKBAMKSZQJGNB-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.56 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|