C23H26ClN3O — CID 95754456
[4-(4-chlorophenyl)piperazin-1-yl]-(1-ethyl-2,3-dimethylindol-5-yl)methanone (PubChem CID 95754456) has the molecular formula C23H26ClN3O and a molecular weight of 395.93 g/mol. Its IUPAC name is [4-(4-chlorophenyl)piperazin-1-yl]-(1-ethyl-2,3-dimethylindol-5-yl)methanone.
| Compound Name | [4-(4-chlorophenyl)piperazin-1-yl]-(1-ethyl-2,3-dimethylindol-5-yl)methanone |
|---|---|
| PubChem CID | 95754456 |
| Molecular Formula | C23H26ClN3O |
| Molecular Weight | 395.93 g/mol |
| Exact Mass | 395.18 |
| IUPAC Name | [4-(4-chlorophenyl)piperazin-1-yl]-(1-ethyl-2,3-dimethylindol-5-yl)methanone |
| SMILES | CCn1c(C)c(C)c2cc(C(=O)N3CCN(c4ccc(Cl)cc4)CC3)ccc21 |
| InChI | InChI=1S/C23H26ClN3O/c1-4-27-17(3)16(2)21-15-18(5-10-22(21)27)23(28)26-13-11-25(12-14-26)20-8-6-19(24)7-9-20/h5-10,15H,4,11-14H2,1-3H3 |
| InChIKey | FUCGDLBCNWSJGX-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 28.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.93 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|