C21H31N3O — CID 51594671
[(3R)-3-[(dimethylamino)methyl]piperidin-1-yl]-(1-ethyl-2,3-dimethylindol-5-yl)methanone (PubChem CID 51594671) has the molecular formula C21H31N3O and a molecular weight of 341.50 g/mol. Its IUPAC name is [(3R)-3-[(dimethylamino)methyl]piperidin-1-yl]-(1-ethyl-2,3-dimethylindol-5-yl)methanone.
| Compound Name | [(3R)-3-[(dimethylamino)methyl]piperidin-1-yl]-(1-ethyl-2,3-dimethylindol-5-yl)methanone |
|---|---|
| PubChem CID | 51594671 |
| Molecular Formula | C21H31N3O |
| Molecular Weight | 341.50 g/mol |
| Exact Mass | 341.25 |
| IUPAC Name | [(3R)-3-[(dimethylamino)methyl]piperidin-1-yl]-(1-ethyl-2,3-dimethylindol-5-yl)methanone |
| SMILES | CCn1c(C)c(C)c2cc(C(=O)N3CCC[C@H](CN(C)C)C3)ccc21 |
| InChI | InChI=1S/C21H31N3O/c1-6-24-16(3)15(2)19-12-18(9-10-20(19)24)21(25)23-11-7-8-17(14-23)13-22(4)5/h9-10,12,17H,6-8,11,13-14H2,1-5H3/t17-/m1/s1 |
| InChIKey | CGGLFUCEYXIFCE-QGZVFWFLSA-N |
| XLogP | 3.69 |
| TPSA | 28.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.50 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|