C27H40N4O4 — CID 171688205
formic acid;N-[(1-methylpiperidin-4-yl)methyl]-2-[1-(1,2,3-trimethylindole-5-carbonyl)piperidin-3-yl]acetamide (PubChem CID 171688205) has the molecular formula C27H40N4O4 and a molecular weight of 484.64 g/mol. Its IUPAC name is formic acid;N-[(1-methylpiperidin-4-yl)methyl]-2-[1-(1,2,3-trimethylindole-5-carbonyl)piperidin-3-yl]acetamide.
| Compound Name | formic acid;N-[(1-methylpiperidin-4-yl)methyl]-2-[1-(1,2,3-trimethylindole-5-carbonyl)piperidin-3-yl]acetamide |
|---|---|
| PubChem CID | 171688205 |
| Molecular Formula | C27H40N4O4 |
| Molecular Weight | 484.64 g/mol |
| Exact Mass | 484.30 |
| IUPAC Name | formic acid;N-[(1-methylpiperidin-4-yl)methyl]-2-[1-(1,2,3-trimethylindole-5-carbonyl)piperidin-3-yl]acetamide |
| SMILES | Cc1c(C)n(C)c2ccc(C(=O)N3CCCC(CC(=O)NCC4CCN(C)CC4)C3)cc12.O=CO |
| InChI | InChI=1S/C26H38N4O2.CH2O2/c1-18-19(2)29(4)24-8-7-22(15-23(18)24)26(32)30-11-5-6-21(17-30)14-25(31)27-16-20-9-12-28(3)13-10-20;2-1-3/h7-8,15,20-21H,5-6,9-14,16-17H2,1-4H3,(H,27,31);1H,(H,2,3) |
| InChIKey | ZEDXYYVIMVKDJY-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 94.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.64 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|