C18H25N3O — CID 20940028
1,2,3-trimethyl-N-(2-pyrrolidin-1-ylethyl)indole-5-carboxamide (PubChem CID 20940028) has the molecular formula C18H25N3O and a molecular weight of 299.42 g/mol. Its IUPAC name is 1,2,3-trimethyl-N-(2-pyrrolidin-1-ylethyl)indole-5-carboxamide.
| Compound Name | 1,2,3-trimethyl-N-(2-pyrrolidin-1-ylethyl)indole-5-carboxamide |
|---|---|
| PubChem CID | 20940028 |
| Molecular Formula | C18H25N3O |
| Molecular Weight | 299.42 g/mol |
| Exact Mass | 299.20 |
| IUPAC Name | 1,2,3-trimethyl-N-(2-pyrrolidin-1-ylethyl)indole-5-carboxamide |
| SMILES | Cc1c(C)n(C)c2ccc(C(=O)NCCN3CCCC3)cc12 |
| InChI | InChI=1S/C18H25N3O/c1-13-14(2)20(3)17-7-6-15(12-16(13)17)18(22)19-8-11-21-9-4-5-10-21/h6-7,12H,4-5,8-11H2,1-3H3,(H,19,22) |
| InChIKey | HPEDKJRZGPYAKJ-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 37.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.42 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|