C26H32ClN3O — CID 20940278
1-[(4-chlorophenyl)methyl]-2,3-dimethyl-N-(3-piperidin-1-ylpropyl)indole-5-carboxamide (PubChem CID 20940278) has the molecular formula C26H32ClN3O and a molecular weight of 438.02 g/mol. Its IUPAC name is 1-[(4-chlorophenyl)methyl]-2,3-dimethyl-N-(3-piperidin-1-ylpropyl)indole-5-carboxamide.
| Compound Name | 1-[(4-chlorophenyl)methyl]-2,3-dimethyl-N-(3-piperidin-1-ylpropyl)indole-5-carboxamide |
|---|---|
| PubChem CID | 20940278 |
| Molecular Formula | C26H32ClN3O |
| Molecular Weight | 438.02 g/mol |
| Exact Mass | 437.22 |
| IUPAC Name | 1-[(4-chlorophenyl)methyl]-2,3-dimethyl-N-(3-piperidin-1-ylpropyl)indole-5-carboxamide |
| SMILES | Cc1c(C)n(Cc2ccc(Cl)cc2)c2ccc(C(=O)NCCCN3CCCCC3)cc12 |
| InChI | InChI=1S/C26H32ClN3O/c1-19-20(2)30(18-21-7-10-23(27)11-8-21)25-12-9-22(17-24(19)25)26(31)28-13-6-16-29-14-4-3-5-15-29/h7-12,17H,3-6,13-16,18H2,1-2H3,(H,28,31) |
| InChIKey | ZQSBDCWTUZQUDY-UHFFFAOYSA-N |
| XLogP | 5.57 |
| TPSA | 37.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.02 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|