C22H30N4O3 — CID 110085800
2-[1-(2-methyl-3H-benzimidazole-5-carbonyl)piperidin-3-yl]-N-(oxan-4-ylmethyl)acetamide (PubChem CID 110085800) has the molecular formula C22H30N4O3 and a molecular weight of 398.51 g/mol. Its IUPAC name is 2-[1-(2-methyl-3H-benzimidazole-5-carbonyl)piperidin-3-yl]-N-(oxan-4-ylmethyl)acetamide.
| Compound Name | 2-[1-(2-methyl-3H-benzimidazole-5-carbonyl)piperidin-3-yl]-N-(oxan-4-ylmethyl)acetamide |
|---|---|
| PubChem CID | 110085800 |
| Molecular Formula | C22H30N4O3 |
| Molecular Weight | 398.51 g/mol |
| Exact Mass | 398.23 |
| IUPAC Name | 2-[1-(2-methyl-3H-benzimidazole-5-carbonyl)piperidin-3-yl]-N-(oxan-4-ylmethyl)acetamide |
| SMILES | Cc1nc2ccc(C(=O)N3CCCC(CC(=O)NCC4CCOCC4)C3)cc2[nH]1 |
| InChI | InChI=1S/C22H30N4O3/c1-15-24-19-5-4-18(12-20(19)25-15)22(28)26-8-2-3-17(14-26)11-21(27)23-13-16-6-9-29-10-7-16/h4-5,12,16-17H,2-3,6-11,13-14H2,1H3,(H,23,27)(H,24,25) |
| InChIKey | PLRDSJQFHZINFN-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 87.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.51 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |