C26H32N4O3 — CID 124992275
N-[2-(3,4-dimethylphenoxy)ethyl]-2-[(3S)-1-(2-methyl-3H-benzimidazole-5-carbonyl)piperidin-3-yl]acetamide (PubChem CID 124992275) has the molecular formula C26H32N4O3 and a molecular weight of 448.57 g/mol. Its IUPAC name is N-[2-(3,4-dimethylphenoxy)ethyl]-2-[(3S)-1-(2-methyl-3H-benzimidazole-5-carbonyl)piperidin-3-yl]acetamide.
| Compound Name | N-[2-(3,4-dimethylphenoxy)ethyl]-2-[(3S)-1-(2-methyl-3H-benzimidazole-5-carbonyl)piperidin-3-yl]acetamide |
|---|---|
| PubChem CID | 124992275 |
| Molecular Formula | C26H32N4O3 |
| Molecular Weight | 448.57 g/mol |
| Exact Mass | 448.25 |
| IUPAC Name | N-[2-(3,4-dimethylphenoxy)ethyl]-2-[(3S)-1-(2-methyl-3H-benzimidazole-5-carbonyl)piperidin-3-yl]acetamide |
| SMILES | Cc1nc2ccc(C(=O)N3CCC[C@@H](CC(=O)NCCOc4ccc(C)c(C)c4)C3)cc2[nH]1 |
| InChI | InChI=1S/C26H32N4O3/c1-17-6-8-22(13-18(17)2)33-12-10-27-25(31)14-20-5-4-11-30(16-20)26(32)21-7-9-23-24(15-21)29-19(3)28-23/h6-9,13,15,20H,4-5,10-12,14,16H2,1-3H3,(H,27,31)(H,28,29)/t20-/m0/s1 |
| InChIKey | PPJKFJFTEREJGG-FQEVSTJZSA-N |
| XLogP | 3.93 |
| TPSA | 87.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.57 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|