C21H29N3O — CID 95749738
(1-ethyl-2,3-dimethylindol-5-yl)-(4-prop-2-enyl-1,4-diazepan-1-yl)methanone (PubChem CID 95749738) has the molecular formula C21H29N3O and a molecular weight of 339.48 g/mol. Its IUPAC name is (1-ethyl-2,3-dimethylindol-5-yl)-(4-prop-2-enyl-1,4-diazepan-1-yl)methanone.
| Compound Name | (1-ethyl-2,3-dimethylindol-5-yl)-(4-prop-2-enyl-1,4-diazepan-1-yl)methanone |
|---|---|
| PubChem CID | 95749738 |
| Molecular Formula | C21H29N3O |
| Molecular Weight | 339.48 g/mol |
| Exact Mass | 339.23 |
| IUPAC Name | (1-ethyl-2,3-dimethylindol-5-yl)-(4-prop-2-enyl-1,4-diazepan-1-yl)methanone |
| SMILES | C=CCN1CCCN(C(=O)c2ccc3c(c2)c(C)c(C)n3CC)CC1 |
| InChI | InChI=1S/C21H29N3O/c1-5-10-22-11-7-12-23(14-13-22)21(25)18-8-9-20-19(15-18)16(3)17(4)24(20)6-2/h5,8-9,15H,1,6-7,10-14H2,2-4H3 |
| InChIKey | RMYSOXNNNLPHIH-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 28.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.48 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|