C18H26N2O4 — CID 95750013
(4-prop-2-enyl-1,4-diazepan-1-yl)-(3,4,5-trimethoxyphenyl)methanone (PubChem CID 95750013) has the molecular formula C18H26N2O4 and a molecular weight of 334.42 g/mol. Its IUPAC name is (4-prop-2-enyl-1,4-diazepan-1-yl)-(3,4,5-trimethoxyphenyl)methanone.
| Compound Name | (4-prop-2-enyl-1,4-diazepan-1-yl)-(3,4,5-trimethoxyphenyl)methanone |
|---|---|
| PubChem CID | 95750013 |
| Molecular Formula | C18H26N2O4 |
| Molecular Weight | 334.42 g/mol |
| Exact Mass | 334.19 |
| IUPAC Name | (4-prop-2-enyl-1,4-diazepan-1-yl)-(3,4,5-trimethoxyphenyl)methanone |
| SMILES | C=CCN1CCCN(C(=O)c2cc(OC)c(OC)c(OC)c2)CC1 |
| InChI | InChI=1S/C18H26N2O4/c1-5-7-19-8-6-9-20(11-10-19)18(21)14-12-15(22-2)17(24-4)16(13-14)23-3/h5,12-13H,1,6-11H2,2-4H3 |
| InChIKey | OIYCPOIHYQQXTJ-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 51.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.42 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|