C18H26N2O3 — CID 119562615
(3,4-dimethoxy-5-prop-2-enylphenyl)-[4-(methylamino)piperidin-1-yl]methanone (PubChem CID 119562615) has the molecular formula C18H26N2O3 and a molecular weight of 318.42 g/mol. Its IUPAC name is (3,4-dimethoxy-5-prop-2-enylphenyl)-[4-(methylamino)piperidin-1-yl]methanone.
| Compound Name | (3,4-dimethoxy-5-prop-2-enylphenyl)-[4-(methylamino)piperidin-1-yl]methanone |
|---|---|
| PubChem CID | 119562615 |
| Molecular Formula | C18H26N2O3 |
| Molecular Weight | 318.42 g/mol |
| Exact Mass | 318.19 |
| IUPAC Name | (3,4-dimethoxy-5-prop-2-enylphenyl)-[4-(methylamino)piperidin-1-yl]methanone |
| SMILES | C=CCc1cc(C(=O)N2CCC(NC)CC2)cc(OC)c1OC |
| InChI | InChI=1S/C18H26N2O3/c1-5-6-13-11-14(12-16(22-3)17(13)23-4)18(21)20-9-7-15(19-2)8-10-20/h5,11-12,15,19H,1,6-10H2,2-4H3 |
| InChIKey | DEOHXIBGXPKGFS-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.42 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|