C23H25F2NO4 — CID 112836488
[4-(2,4-difluorophenoxy)piperidin-1-yl]-(3,4-dimethoxy-5-prop-2-enylphenyl)methanone (PubChem CID 112836488) has the molecular formula C23H25F2NO4 and a molecular weight of 417.45 g/mol. Its IUPAC name is [4-(2,4-difluorophenoxy)piperidin-1-yl]-(3,4-dimethoxy-5-prop-2-enylphenyl)methanone.
| Compound Name | [4-(2,4-difluorophenoxy)piperidin-1-yl]-(3,4-dimethoxy-5-prop-2-enylphenyl)methanone |
|---|---|
| PubChem CID | 112836488 |
| Molecular Formula | C23H25F2NO4 |
| Molecular Weight | 417.45 g/mol |
| Exact Mass | 417.18 |
| IUPAC Name | [4-(2,4-difluorophenoxy)piperidin-1-yl]-(3,4-dimethoxy-5-prop-2-enylphenyl)methanone |
| SMILES | C=CCc1cc(C(=O)N2CCC(Oc3ccc(F)cc3F)CC2)cc(OC)c1OC |
| InChI | InChI=1S/C23H25F2NO4/c1-4-5-15-12-16(13-21(28-2)22(15)29-3)23(27)26-10-8-18(9-11-26)30-20-7-6-17(24)14-19(20)25/h4,6-7,12-14,18H,1,5,8-11H2,2-3H3 |
| InChIKey | UOCIUJKJJHIGGR-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.45 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|