C20H25NO5 — CID 120978433
(3R,4R)-4-cyclopropyl-1-(3,4-dimethoxy-5-prop-2-enylbenzoyl)pyrrolidine-3-carboxylic acid (PubChem CID 120978433) has the molecular formula C20H25NO5 and a molecular weight of 359.42 g/mol. Its IUPAC name is (3R,4R)-4-cyclopropyl-1-(3,4-dimethoxy-5-prop-2-enylbenzoyl)pyrrolidine-3-carboxylic acid.
| Compound Name | (3R,4R)-4-cyclopropyl-1-(3,4-dimethoxy-5-prop-2-enylbenzoyl)pyrrolidine-3-carboxylic acid |
|---|---|
| PubChem CID | 120978433 |
| Molecular Formula | C20H25NO5 |
| Molecular Weight | 359.42 g/mol |
| Exact Mass | 359.17 |
| IUPAC Name | (3R,4R)-4-cyclopropyl-1-(3,4-dimethoxy-5-prop-2-enylbenzoyl)pyrrolidine-3-carboxylic acid |
| SMILES | C=CCc1cc(C(=O)N2C[C@H](C(=O)O)[C@@H](C3CC3)C2)cc(OC)c1OC |
| InChI | InChI=1S/C20H25NO5/c1-4-5-13-8-14(9-17(25-2)18(13)26-3)19(22)21-10-15(12-6-7-12)16(11-21)20(23)24/h4,8-9,12,15-16H,1,5-7,10-11H2,2-3H3,(H,23,24)/t15-,16+/m1/s1 |
| InChIKey | LQKHWZYMSCPJRL-CVEARBPZSA-N |
| XLogP | 2.62 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.42 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|