C23H29ClN2O3 — CID 120742608
[(3R,4R)-3-(aminomethyl)-4-phenylpyrrolidin-1-yl]-(3,4-dimethoxy-5-prop-2-enylphenyl)methanone;hydrochloride (PubChem CID 120742608) has the molecular formula C23H29ClN2O3 and a molecular weight of 416.95 g/mol. Its IUPAC name is [(3R,4R)-3-(aminomethyl)-4-phenylpyrrolidin-1-yl]-(3,4-dimethoxy-5-prop-2-enylphenyl)methanone;hydrochloride.
| Compound Name | [(3R,4R)-3-(aminomethyl)-4-phenylpyrrolidin-1-yl]-(3,4-dimethoxy-5-prop-2-enylphenyl)methanone;hydrochloride |
|---|---|
| PubChem CID | 120742608 |
| Molecular Formula | C23H29ClN2O3 |
| Molecular Weight | 416.95 g/mol |
| Exact Mass | 416.19 |
| IUPAC Name | [(3R,4R)-3-(aminomethyl)-4-phenylpyrrolidin-1-yl]-(3,4-dimethoxy-5-prop-2-enylphenyl)methanone;hydrochloride |
| SMILES | C=CCc1cc(C(=O)N2C[C@@H](CN)[C@H](c3ccccc3)C2)cc(OC)c1OC.Cl |
| InChI | InChI=1S/C23H28N2O3.ClH/c1-4-8-17-11-18(12-21(27-2)22(17)28-3)23(26)25-14-19(13-24)20(15-25)16-9-6-5-7-10-16;/h4-7,9-12,19-20H,1,8,13-15,24H2,2-3H3;1H/t19-,20+;/m1./s1 |
| InChIKey | FLFGLKYEQHBJGC-FDOHDBATSA-N |
| XLogP | 3.67 |
| TPSA | 64.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.95 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|