C24H28N2O4 — CID 27009194
1-[4-[4-(3,4-dimethoxy-5-prop-2-enylbenzoyl)piperazin-1-yl]phenyl]ethanone (PubChem CID 27009194) has the molecular formula C24H28N2O4 and a molecular weight of 408.50 g/mol. Its IUPAC name is 1-[4-[4-(3,4-dimethoxy-5-prop-2-enylbenzoyl)piperazin-1-yl]phenyl]ethanone.
| Compound Name | 1-[4-[4-(3,4-dimethoxy-5-prop-2-enylbenzoyl)piperazin-1-yl]phenyl]ethanone |
|---|---|
| PubChem CID | 27009194 |
| Molecular Formula | C24H28N2O4 |
| Molecular Weight | 408.50 g/mol |
| Exact Mass | 408.20 |
| IUPAC Name | 1-[4-[4-(3,4-dimethoxy-5-prop-2-enylbenzoyl)piperazin-1-yl]phenyl]ethanone |
| SMILES | C=CCc1cc(C(=O)N2CCN(c3ccc(C(C)=O)cc3)CC2)cc(OC)c1OC |
| InChI | InChI=1S/C24H28N2O4/c1-5-6-19-15-20(16-22(29-3)23(19)30-4)24(28)26-13-11-25(12-14-26)21-9-7-18(8-10-21)17(2)27/h5,7-10,15-16H,1,6,11-14H2,2-4H3 |
| InChIKey | ZAXCDVAYYOQWDM-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.50 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|