C21H30N2O3 — CID 119624177
[4-(cyclopropylmethylamino)piperidin-1-yl]-(3,4-dimethoxy-5-prop-2-enylphenyl)methanone (PubChem CID 119624177) has the molecular formula C21H30N2O3 and a molecular weight of 358.48 g/mol. Its IUPAC name is [4-(cyclopropylmethylamino)piperidin-1-yl]-(3,4-dimethoxy-5-prop-2-enylphenyl)methanone.
| Compound Name | [4-(cyclopropylmethylamino)piperidin-1-yl]-(3,4-dimethoxy-5-prop-2-enylphenyl)methanone |
|---|---|
| PubChem CID | 119624177 |
| Molecular Formula | C21H30N2O3 |
| Molecular Weight | 358.48 g/mol |
| Exact Mass | 358.23 |
| IUPAC Name | [4-(cyclopropylmethylamino)piperidin-1-yl]-(3,4-dimethoxy-5-prop-2-enylphenyl)methanone |
| SMILES | C=CCc1cc(C(=O)N2CCC(NCC3CC3)CC2)cc(OC)c1OC |
| InChI | InChI=1S/C21H30N2O3/c1-4-5-16-12-17(13-19(25-2)20(16)26-3)21(24)23-10-8-18(9-11-23)22-14-15-6-7-15/h4,12-13,15,18,22H,1,5-11,14H2,2-3H3 |
| InChIKey | MCTXVEXAWFJQSQ-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.48 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|