C18H25NO4 — CID 86911892
N-(4-hydroxycyclohexyl)-3,4-dimethoxy-5-prop-2-enylbenzamide (PubChem CID 86911892) has the molecular formula C18H25NO4 and a molecular weight of 319.40 g/mol. Its IUPAC name is N-(4-hydroxycyclohexyl)-3,4-dimethoxy-5-prop-2-enylbenzamide.
| Compound Name | N-(4-hydroxycyclohexyl)-3,4-dimethoxy-5-prop-2-enylbenzamide |
|---|---|
| PubChem CID | 86911892 |
| Molecular Formula | C18H25NO4 |
| Molecular Weight | 319.40 g/mol |
| Exact Mass | 319.18 |
| IUPAC Name | N-(4-hydroxycyclohexyl)-3,4-dimethoxy-5-prop-2-enylbenzamide |
| SMILES | C=CCc1cc(C(=O)NC2CCC(O)CC2)cc(OC)c1OC |
| InChI | InChI=1S/C18H25NO4/c1-4-5-12-10-13(11-16(22-2)17(12)23-3)18(21)19-14-6-8-15(20)9-7-14/h4,10-11,14-15,20H,1,5-9H2,2-3H3,(H,19,21) |
| InChIKey | WETKJVYGONDMBW-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.40 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|