C19H24F3NO3 — CID 43046830
3,4-dimethoxy-5-prop-2-enyl-N-[2-(trifluoromethyl)cyclohexyl]benzamide (PubChem CID 43046830) has the molecular formula C19H24F3NO3 and a molecular weight of 371.40 g/mol. Its IUPAC name is 3,4-dimethoxy-5-prop-2-enyl-N-[2-(trifluoromethyl)cyclohexyl]benzamide.
| Compound Name | 3,4-dimethoxy-5-prop-2-enyl-N-[2-(trifluoromethyl)cyclohexyl]benzamide |
|---|---|
| PubChem CID | 43046830 |
| Molecular Formula | C19H24F3NO3 |
| Molecular Weight | 371.40 g/mol |
| Exact Mass | 371.17 |
| IUPAC Name | 3,4-dimethoxy-5-prop-2-enyl-N-[2-(trifluoromethyl)cyclohexyl]benzamide |
| SMILES | C=CCc1cc(C(=O)NC2CCCCC2C(F)(F)F)cc(OC)c1OC |
| InChI | InChI=1S/C19H24F3NO3/c1-4-7-12-10-13(11-16(25-2)17(12)26-3)18(24)23-15-9-6-5-8-14(15)19(20,21)22/h4,10-11,14-15H,1,5-9H2,2-3H3,(H,23,24) |
| InChIKey | PMJPQMPJUNVLPK-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.40 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|