C19H29NO3 — CID 55451236
3,4-dimethoxy-N-(5-methylhexan-2-yl)-5-prop-2-enylbenzamide (PubChem CID 55451236) has the molecular formula C19H29NO3 and a molecular weight of 319.45 g/mol. Its IUPAC name is 3,4-dimethoxy-N-(5-methylhexan-2-yl)-5-prop-2-enylbenzamide.
| Compound Name | 3,4-dimethoxy-N-(5-methylhexan-2-yl)-5-prop-2-enylbenzamide |
|---|---|
| PubChem CID | 55451236 |
| Molecular Formula | C19H29NO3 |
| Molecular Weight | 319.45 g/mol |
| Exact Mass | 319.21 |
| IUPAC Name | 3,4-dimethoxy-N-(5-methylhexan-2-yl)-5-prop-2-enylbenzamide |
| SMILES | C=CCc1cc(C(=O)NC(C)CCC(C)C)cc(OC)c1OC |
| InChI | InChI=1S/C19H29NO3/c1-7-8-15-11-16(12-17(22-5)18(15)23-6)19(21)20-14(4)10-9-13(2)3/h7,11-14H,1,8-10H2,2-6H3,(H,20,21) |
| InChIKey | AOSHEOQNLMGSSU-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.45 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|