C23H29NO4 — CID 55748619
3,4-dimethoxy-N-[[4-(propan-2-yloxymethyl)phenyl]methyl]-5-prop-2-enylbenzamide (PubChem CID 55748619) has the molecular formula C23H29NO4 and a molecular weight of 383.49 g/mol. Its IUPAC name is 3,4-dimethoxy-N-[[4-(propan-2-yloxymethyl)phenyl]methyl]-5-prop-2-enylbenzamide.
| Compound Name | 3,4-dimethoxy-N-[[4-(propan-2-yloxymethyl)phenyl]methyl]-5-prop-2-enylbenzamide |
|---|---|
| PubChem CID | 55748619 |
| Molecular Formula | C23H29NO4 |
| Molecular Weight | 383.49 g/mol |
| Exact Mass | 383.21 |
| IUPAC Name | 3,4-dimethoxy-N-[[4-(propan-2-yloxymethyl)phenyl]methyl]-5-prop-2-enylbenzamide |
| SMILES | C=CCc1cc(C(=O)NCc2ccc(COC(C)C)cc2)cc(OC)c1OC |
| InChI | InChI=1S/C23H29NO4/c1-6-7-19-12-20(13-21(26-4)22(19)27-5)23(25)24-14-17-8-10-18(11-9-17)15-28-16(2)3/h6,8-13,16H,1,7,14-15H2,2-5H3,(H,24,25) |
| InChIKey | UVOGYAFTYHSXEE-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.49 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|