C22H24F3NO4 — CID 18271704
3,4-dimethoxy-5-prop-2-enyl-N-[[4-(2,2,2-trifluoroethoxymethyl)phenyl]methyl]benzamide (PubChem CID 18271704) has the molecular formula C22H24F3NO4 and a molecular weight of 423.43 g/mol. Its IUPAC name is 3,4-dimethoxy-5-prop-2-enyl-N-[[4-(2,2,2-trifluoroethoxymethyl)phenyl]methyl]benzamide.
| Compound Name | 3,4-dimethoxy-5-prop-2-enyl-N-[[4-(2,2,2-trifluoroethoxymethyl)phenyl]methyl]benzamide |
|---|---|
| PubChem CID | 18271704 |
| Molecular Formula | C22H24F3NO4 |
| Molecular Weight | 423.43 g/mol |
| Exact Mass | 423.17 |
| IUPAC Name | 3,4-dimethoxy-5-prop-2-enyl-N-[[4-(2,2,2-trifluoroethoxymethyl)phenyl]methyl]benzamide |
| SMILES | C=CCc1cc(C(=O)NCc2ccc(COCC(F)(F)F)cc2)cc(OC)c1OC |
| InChI | InChI=1S/C22H24F3NO4/c1-4-5-17-10-18(11-19(28-2)20(17)29-3)21(27)26-12-15-6-8-16(9-7-15)13-30-14-22(23,24)25/h4,6-11H,1,5,12-14H2,2-3H3,(H,26,27) |
| InChIKey | ITIBXGLACQVFTI-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.43 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|