C23H27N3O4 — CID 55681129
3,4-dimethoxy-N-[[4-(3-oxopiperazin-1-yl)phenyl]methyl]-5-prop-2-enylbenzamide (PubChem CID 55681129) has the molecular formula C23H27N3O4 and a molecular weight of 409.49 g/mol. Its IUPAC name is 3,4-dimethoxy-N-[[4-(3-oxopiperazin-1-yl)phenyl]methyl]-5-prop-2-enylbenzamide.
| Compound Name | 3,4-dimethoxy-N-[[4-(3-oxopiperazin-1-yl)phenyl]methyl]-5-prop-2-enylbenzamide |
|---|---|
| PubChem CID | 55681129 |
| Molecular Formula | C23H27N3O4 |
| Molecular Weight | 409.49 g/mol |
| Exact Mass | 409.20 |
| IUPAC Name | 3,4-dimethoxy-N-[[4-(3-oxopiperazin-1-yl)phenyl]methyl]-5-prop-2-enylbenzamide |
| SMILES | C=CCc1cc(C(=O)NCc2ccc(N3CCNC(=O)C3)cc2)cc(OC)c1OC |
| InChI | InChI=1S/C23H27N3O4/c1-4-5-17-12-18(13-20(29-2)22(17)30-3)23(28)25-14-16-6-8-19(9-7-16)26-11-10-24-21(27)15-26/h4,6-9,12-13H,1,5,10-11,14-15H2,2-3H3,(H,24,27)(H,25,28) |
| InChIKey | CYRFDAPNJYMVPW-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.49 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|