C23H24N4O4S — CID 46462146
3-methoxy-N-[[4-(3-oxopiperazin-1-yl)phenyl]methyl]-4-(1,3-thiazol-4-ylmethoxy)benzamide (PubChem CID 46462146) has the molecular formula C23H24N4O4S and a molecular weight of 452.54 g/mol. Its IUPAC name is 3-methoxy-N-[[4-(3-oxopiperazin-1-yl)phenyl]methyl]-4-(1,3-thiazol-4-ylmethoxy)benzamide.
| Compound Name | 3-methoxy-N-[[4-(3-oxopiperazin-1-yl)phenyl]methyl]-4-(1,3-thiazol-4-ylmethoxy)benzamide |
|---|---|
| PubChem CID | 46462146 |
| Molecular Formula | C23H24N4O4S |
| Molecular Weight | 452.54 g/mol |
| Exact Mass | 452.15 |
| IUPAC Name | 3-methoxy-N-[[4-(3-oxopiperazin-1-yl)phenyl]methyl]-4-(1,3-thiazol-4-ylmethoxy)benzamide |
| SMILES | COc1cc(C(=O)NCc2ccc(N3CCNC(=O)C3)cc2)ccc1OCc1cscn1 |
| InChI | InChI=1S/C23H24N4O4S/c1-30-21-10-17(4-7-20(21)31-13-18-14-32-15-26-18)23(29)25-11-16-2-5-19(6-3-16)27-9-8-24-22(28)12-27/h2-7,10,14-15H,8-9,11-13H2,1H3,(H,24,28)(H,25,29) |
| InChIKey | BQSILDALFQBEGW-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 92.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.54 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|