C21H24F2N4O4 — CID 38289897
1-[[4-(difluoromethoxy)-3-methoxyphenyl]methyl]-3-[[4-(3-oxopiperazin-1-yl)phenyl]methyl]urea (PubChem CID 38289897) has the molecular formula C21H24F2N4O4 and a molecular weight of 434.44 g/mol. Its IUPAC name is 1-[[4-(difluoromethoxy)-3-methoxyphenyl]methyl]-3-[[4-(3-oxopiperazin-1-yl)phenyl]methyl]urea.
| Compound Name | 1-[[4-(difluoromethoxy)-3-methoxyphenyl]methyl]-3-[[4-(3-oxopiperazin-1-yl)phenyl]methyl]urea |
|---|---|
| PubChem CID | 38289897 |
| Molecular Formula | C21H24F2N4O4 |
| Molecular Weight | 434.44 g/mol |
| Exact Mass | 434.18 |
| IUPAC Name | 1-[[4-(difluoromethoxy)-3-methoxyphenyl]methyl]-3-[[4-(3-oxopiperazin-1-yl)phenyl]methyl]urea |
| SMILES | COc1cc(CNC(=O)NCc2ccc(N3CCNC(=O)C3)cc2)ccc1OC(F)F |
| InChI | InChI=1S/C21H24F2N4O4/c1-30-18-10-15(4-7-17(18)31-20(22)23)12-26-21(29)25-11-14-2-5-16(6-3-14)27-9-8-24-19(28)13-27/h2-7,10,20H,8-9,11-13H2,1H3,(H,24,28)(H2,25,26,29) |
| InChIKey | KHPMPRMYFLBKQE-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 91.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.44 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|