C16H20N2O4 — CID 75450076
3,4-dimethoxy-N-(5-oxopyrrolidin-3-yl)-5-prop-2-enylbenzamide (PubChem CID 75450076) has the molecular formula C16H20N2O4 and a molecular weight of 304.35 g/mol. Its IUPAC name is 3,4-dimethoxy-N-(5-oxopyrrolidin-3-yl)-5-prop-2-enylbenzamide.
| Compound Name | 3,4-dimethoxy-N-(5-oxopyrrolidin-3-yl)-5-prop-2-enylbenzamide |
|---|---|
| PubChem CID | 75450076 |
| Molecular Formula | C16H20N2O4 |
| Molecular Weight | 304.35 g/mol |
| Exact Mass | 304.14 |
| IUPAC Name | 3,4-dimethoxy-N-(5-oxopyrrolidin-3-yl)-5-prop-2-enylbenzamide |
| SMILES | C=CCc1cc(C(=O)NC2CNC(=O)C2)cc(OC)c1OC |
| InChI | InChI=1S/C16H20N2O4/c1-4-5-10-6-11(7-13(21-2)15(10)22-3)16(20)18-12-8-14(19)17-9-12/h4,6-7,12H,1,5,8-9H2,2-3H3,(H,17,19)(H,18,20) |
| InChIKey | XZKVLCOTRJMVPI-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.35 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|