C21H32N2O5 — CID 108544146
2-ethyl-1-[4-(3,4,5-trimethoxybenzoyl)-1,4-diazepan-1-yl]butan-1-one (PubChem CID 108544146) has the molecular formula C21H32N2O5 and a molecular weight of 392.50 g/mol. Its IUPAC name is 2-ethyl-1-[4-(3,4,5-trimethoxybenzoyl)-1,4-diazepan-1-yl]butan-1-one.
| Compound Name | 2-ethyl-1-[4-(3,4,5-trimethoxybenzoyl)-1,4-diazepan-1-yl]butan-1-one |
|---|---|
| PubChem CID | 108544146 |
| Molecular Formula | C21H32N2O5 |
| Molecular Weight | 392.50 g/mol |
| Exact Mass | 392.23 |
| IUPAC Name | 2-ethyl-1-[4-(3,4,5-trimethoxybenzoyl)-1,4-diazepan-1-yl]butan-1-one |
| SMILES | CCC(CC)C(=O)N1CCCN(C(=O)c2cc(OC)c(OC)c(OC)c2)CC1 |
| InChI | InChI=1S/C21H32N2O5/c1-6-15(7-2)20(24)22-9-8-10-23(12-11-22)21(25)16-13-17(26-3)19(28-5)18(14-16)27-4/h13-15H,6-12H2,1-5H3 |
| InChIKey | CINHZXXKWVZBIH-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 68.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.50 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |