C14H22N4O — CID 91945365
(1,5-dimethylpyrazol-3-yl)-(4-prop-2-enyl-1,4-diazepan-1-yl)methanone (PubChem CID 91945365) has the molecular formula C14H22N4O and a molecular weight of 262.36 g/mol. Its IUPAC name is (1,5-dimethylpyrazol-3-yl)-(4-prop-2-enyl-1,4-diazepan-1-yl)methanone.
| Compound Name | (1,5-dimethylpyrazol-3-yl)-(4-prop-2-enyl-1,4-diazepan-1-yl)methanone |
|---|---|
| PubChem CID | 91945365 |
| Molecular Formula | C14H22N4O |
| Molecular Weight | 262.36 g/mol |
| Exact Mass | 262.18 |
| IUPAC Name | (1,5-dimethylpyrazol-3-yl)-(4-prop-2-enyl-1,4-diazepan-1-yl)methanone |
| SMILES | C=CCN1CCCN(C(=O)c2cc(C)n(C)n2)CC1 |
| InChI | InChI=1S/C14H22N4O/c1-4-6-17-7-5-8-18(10-9-17)14(19)13-11-12(2)16(3)15-13/h4,11H,1,5-10H2,2-3H3 |
| InChIKey | SENPFJOTDDFZRV-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 41.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.36 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|