C21H28N4O2 — CID 95749817
[1-[(2,4-dimethylphenoxy)methyl]pyrazol-3-yl]-(4-prop-2-enyl-1,4-diazepan-1-yl)methanone (PubChem CID 95749817) has the molecular formula C21H28N4O2 and a molecular weight of 368.48 g/mol. Its IUPAC name is [1-[(2,4-dimethylphenoxy)methyl]pyrazol-3-yl]-(4-prop-2-enyl-1,4-diazepan-1-yl)methanone.
| Compound Name | [1-[(2,4-dimethylphenoxy)methyl]pyrazol-3-yl]-(4-prop-2-enyl-1,4-diazepan-1-yl)methanone |
|---|---|
| PubChem CID | 95749817 |
| Molecular Formula | C21H28N4O2 |
| Molecular Weight | 368.48 g/mol |
| Exact Mass | 368.22 |
| IUPAC Name | [1-[(2,4-dimethylphenoxy)methyl]pyrazol-3-yl]-(4-prop-2-enyl-1,4-diazepan-1-yl)methanone |
| SMILES | C=CCN1CCCN(C(=O)c2ccn(COc3ccc(C)cc3C)n2)CC1 |
| InChI | InChI=1S/C21H28N4O2/c1-4-9-23-10-5-11-24(14-13-23)21(26)19-8-12-25(22-19)16-27-20-7-6-17(2)15-18(20)3/h4,6-8,12,15H,1,5,9-11,13-14,16H2,2-3H3 |
| InChIKey | NMMVJCKUBMRWCW-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 50.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.48 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|