C29H29N3O2 — CID 1074923
[4-(1-benzyl-2,3-dimethylindole-5-carbonyl)piperazin-1-yl]-phenylmethanone (PubChem CID 1074923) has the molecular formula C29H29N3O2 and a molecular weight of 451.57 g/mol. Its IUPAC name is [4-(1-benzyl-2,3-dimethylindole-5-carbonyl)piperazin-1-yl]-phenylmethanone.
| Compound Name | [4-(1-benzyl-2,3-dimethylindole-5-carbonyl)piperazin-1-yl]-phenylmethanone |
|---|---|
| PubChem CID | 1074923 |
| Molecular Formula | C29H29N3O2 |
| Molecular Weight | 451.57 g/mol |
| Exact Mass | 451.23 |
| IUPAC Name | [4-(1-benzyl-2,3-dimethylindole-5-carbonyl)piperazin-1-yl]-phenylmethanone |
| SMILES | Cc1c(C)n(Cc2ccccc2)c2ccc(C(=O)N3CCN(C(=O)c4ccccc4)CC3)cc12 |
| InChI | InChI=1S/C29H29N3O2/c1-21-22(2)32(20-23-9-5-3-6-10-23)27-14-13-25(19-26(21)27)29(34)31-17-15-30(16-18-31)28(33)24-11-7-4-8-12-24/h3-14,19H,15-18,20H2,1-2H3 |
| InChIKey | ABWLRZMWYUZBJZ-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 45.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.57 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|