C20H21NO4 — CID 155061325
1-[[3-[hydroxy(methoxy)methyl]phenyl]methyl]-2,3-dimethylindole-5-carboxylic acid (PubChem CID 155061325) has the molecular formula C20H21NO4 and a molecular weight of 339.39 g/mol. Its IUPAC name is 1-[[3-[hydroxy(methoxy)methyl]phenyl]methyl]-2,3-dimethylindole-5-carboxylic acid.
| Compound Name | 1-[[3-[hydroxy(methoxy)methyl]phenyl]methyl]-2,3-dimethylindole-5-carboxylic acid |
|---|---|
| PubChem CID | 155061325 |
| Molecular Formula | C20H21NO4 |
| Molecular Weight | 339.39 g/mol |
| Exact Mass | 339.15 |
| IUPAC Name | 1-[[3-[hydroxy(methoxy)methyl]phenyl]methyl]-2,3-dimethylindole-5-carboxylic acid |
| SMILES | COC(O)c1cccc(Cn2c(C)c(C)c3cc(C(=O)O)ccc32)c1 |
| InChI | InChI=1S/C20H21NO4/c1-12-13(2)21(18-8-7-15(19(22)23)10-17(12)18)11-14-5-4-6-16(9-14)20(24)25-3/h4-10,20,24H,11H2,1-3H3,(H,22,23) |
| InChIKey | VJCVILNVQGEVHY-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 71.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.39 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|