C24H27NO4 — CID 89273700
2,3-dimethyl-1-[[4-[1-(1-methylperoxyethyl)cyclopropyl]phenyl]methyl]indole-5-carboxylic acid (PubChem CID 89273700) has the molecular formula C24H27NO4 and a molecular weight of 393.48 g/mol. Its IUPAC name is 2,3-dimethyl-1-[[4-[1-(1-methylperoxyethyl)cyclopropyl]phenyl]methyl]indole-5-carboxylic acid.
| Compound Name | 2,3-dimethyl-1-[[4-[1-(1-methylperoxyethyl)cyclopropyl]phenyl]methyl]indole-5-carboxylic acid |
|---|---|
| PubChem CID | 89273700 |
| Molecular Formula | C24H27NO4 |
| Molecular Weight | 393.48 g/mol |
| Exact Mass | 393.19 |
| IUPAC Name | 2,3-dimethyl-1-[[4-[1-(1-methylperoxyethyl)cyclopropyl]phenyl]methyl]indole-5-carboxylic acid |
| SMILES | COOC(C)C1(c2ccc(Cn3c(C)c(C)c4cc(C(=O)O)ccc43)cc2)CC1 |
| InChI | InChI=1S/C24H27NO4/c1-15-16(2)25(22-10-7-19(23(26)27)13-21(15)22)14-18-5-8-20(9-6-18)24(11-12-24)17(3)29-28-4/h5-10,13,17H,11-12,14H2,1-4H3,(H,26,27) |
| InChIKey | PBVDDVXTIZKLJL-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.48 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|