C32H35BrN2O3 — CID 89273699
N-[(1S)-1-(3-bromophenyl)ethyl]-2,3-dimethyl-1-[[4-[1-(1-methylperoxyethyl)cyclopropyl]phenyl]methyl]indole-5-carboxamide (PubChem CID 89273699) has the molecular formula C32H35BrN2O3 and a molecular weight of 575.55 g/mol. Its IUPAC name is N-[(1S)-1-(3-bromophenyl)ethyl]-2,3-dimethyl-1-[[4-[1-(1-methylperoxyethyl)cyclopropyl]phenyl]methyl]indole-5-carboxamide.
| Compound Name | N-[(1S)-1-(3-bromophenyl)ethyl]-2,3-dimethyl-1-[[4-[1-(1-methylperoxyethyl)cyclopropyl]phenyl]methyl]indole-5-carboxamide |
|---|---|
| PubChem CID | 89273699 |
| Molecular Formula | C32H35BrN2O3 |
| Molecular Weight | 575.55 g/mol |
| Exact Mass | 574.18 |
| IUPAC Name | N-[(1S)-1-(3-bromophenyl)ethyl]-2,3-dimethyl-1-[[4-[1-(1-methylperoxyethyl)cyclopropyl]phenyl]methyl]indole-5-carboxamide |
| SMILES | COOC(C)C1(c2ccc(Cn3c(C)c(C)c4cc(C(=O)N[C@@H](C)c5cccc(Br)c5)ccc43)cc2)CC1 |
| InChI | InChI=1S/C32H35BrN2O3/c1-20-22(3)35(19-24-9-12-27(13-10-24)32(15-16-32)23(4)38-37-5)30-14-11-26(18-29(20)30)31(36)34-21(2)25-7-6-8-28(33)17-25/h6-14,17-18,21,23H,15-16,19H2,1-5H3,(H,34,36)/t21-,23?/m0/s1 |
| InChIKey | QAORXRYJCKDBLW-BBQAJUCSSA-N |
| XLogP | 7.56 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.55 |
| LogP ≤ 5 | 7.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|