C16H15NO2S — CID 29267362
2,3-dimethyl-1-(thiophen-2-ylmethyl)indole-5-carboxylic acid (PubChem CID 29267362) has the molecular formula C16H15NO2S and a molecular weight of 285.37 g/mol. Its IUPAC name is 2,3-dimethyl-1-(thiophen-2-ylmethyl)indole-5-carboxylic acid.
| Compound Name | 2,3-dimethyl-1-(thiophen-2-ylmethyl)indole-5-carboxylic acid |
|---|---|
| PubChem CID | 29267362 |
| Molecular Formula | C16H15NO2S |
| Molecular Weight | 285.37 g/mol |
| Exact Mass | 285.08 |
| IUPAC Name | 2,3-dimethyl-1-(thiophen-2-ylmethyl)indole-5-carboxylic acid |
| SMILES | Cc1c(C)n(Cc2cccs2)c2ccc(C(=O)O)cc12 |
| InChI | InChI=1S/C16H15NO2S/c1-10-11(2)17(9-13-4-3-7-20-13)15-6-5-12(16(18)19)8-14(10)15/h3-8H,9H2,1-2H3,(H,18,19) |
| InChIKey | YANFSNZCHWOPRJ-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 42.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.37 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|