C17H23NO3 — CID 115942933
2,3-dimethyl-1-[2-[(2-methylpropan-2-yl)oxy]ethyl]indole-5-carboxylic acid (PubChem CID 115942933) has the molecular formula C17H23NO3 and a molecular weight of 289.38 g/mol. Its IUPAC name is 2,3-dimethyl-1-[2-[(2-methylpropan-2-yl)oxy]ethyl]indole-5-carboxylic acid.
| Compound Name | 2,3-dimethyl-1-[2-[(2-methylpropan-2-yl)oxy]ethyl]indole-5-carboxylic acid |
|---|---|
| PubChem CID | 115942933 |
| Molecular Formula | C17H23NO3 |
| Molecular Weight | 289.38 g/mol |
| Exact Mass | 289.17 |
| IUPAC Name | 2,3-dimethyl-1-[2-[(2-methylpropan-2-yl)oxy]ethyl]indole-5-carboxylic acid |
| SMILES | Cc1c(C)n(CCOC(C)(C)C)c2ccc(C(=O)O)cc12 |
| InChI | InChI=1S/C17H23NO3/c1-11-12(2)18(8-9-21-17(3,4)5)15-7-6-13(16(19)20)10-14(11)15/h6-7,10H,8-9H2,1-5H3,(H,19,20) |
| InChIKey | JSZBMDCQBBDIGR-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 51.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.38 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|