C18H24N2O4 — CID 119209526
2-[[1-(2-methoxyethyl)-2,3-dimethylindole-5-carbonyl]-methylamino]propanoic acid (PubChem CID 119209526) has the molecular formula C18H24N2O4 and a molecular weight of 332.40 g/mol. Its IUPAC name is 2-[[1-(2-methoxyethyl)-2,3-dimethylindole-5-carbonyl]-methylamino]propanoic acid.
| Compound Name | 2-[[1-(2-methoxyethyl)-2,3-dimethylindole-5-carbonyl]-methylamino]propanoic acid |
|---|---|
| PubChem CID | 119209526 |
| Molecular Formula | C18H24N2O4 |
| Molecular Weight | 332.40 g/mol |
| Exact Mass | 332.17 |
| IUPAC Name | 2-[[1-(2-methoxyethyl)-2,3-dimethylindole-5-carbonyl]-methylamino]propanoic acid |
| SMILES | COCCn1c(C)c(C)c2cc(C(=O)N(C)C(C)C(=O)O)ccc21 |
| InChI | InChI=1S/C18H24N2O4/c1-11-12(2)20(8-9-24-5)16-7-6-14(10-15(11)16)17(21)19(4)13(3)18(22)23/h6-7,10,13H,8-9H2,1-5H3,(H,22,23) |
| InChIKey | DRFSMOKKWQLZSZ-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 71.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.40 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|