C22H26N2O5 — CID 119222680
5-[[[1-(2-methoxyethyl)-2,3-dimethylindole-5-carbonyl]-methylamino]methyl]-2-methylfuran-3-carboxylic acid (PubChem CID 119222680) has the molecular formula C22H26N2O5 and a molecular weight of 398.46 g/mol. Its IUPAC name is 5-[[[1-(2-methoxyethyl)-2,3-dimethylindole-5-carbonyl]-methylamino]methyl]-2-methylfuran-3-carboxylic acid.
| Compound Name | 5-[[[1-(2-methoxyethyl)-2,3-dimethylindole-5-carbonyl]-methylamino]methyl]-2-methylfuran-3-carboxylic acid |
|---|---|
| PubChem CID | 119222680 |
| Molecular Formula | C22H26N2O5 |
| Molecular Weight | 398.46 g/mol |
| Exact Mass | 398.18 |
| IUPAC Name | 5-[[[1-(2-methoxyethyl)-2,3-dimethylindole-5-carbonyl]-methylamino]methyl]-2-methylfuran-3-carboxylic acid |
| SMILES | COCCn1c(C)c(C)c2cc(C(=O)N(C)Cc3cc(C(=O)O)c(C)o3)ccc21 |
| InChI | InChI=1S/C22H26N2O5/c1-13-14(2)24(8-9-28-5)20-7-6-16(10-18(13)20)21(25)23(4)12-17-11-19(22(26)27)15(3)29-17/h6-7,10-11H,8-9,12H2,1-5H3,(H,26,27) |
| InChIKey | FHOYVJHSANRCAB-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 84.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.46 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|