C19H22FNO6 — CID 119222839
5-[[[4-fluoro-3-(2-methoxyethoxymethyl)benzoyl]-methylamino]methyl]-2-methylfuran-3-carboxylic acid (PubChem CID 119222839) has the molecular formula C19H22FNO6 and a molecular weight of 379.38 g/mol. Its IUPAC name is 5-[[[4-fluoro-3-(2-methoxyethoxymethyl)benzoyl]-methylamino]methyl]-2-methylfuran-3-carboxylic acid.
| Compound Name | 5-[[[4-fluoro-3-(2-methoxyethoxymethyl)benzoyl]-methylamino]methyl]-2-methylfuran-3-carboxylic acid |
|---|---|
| PubChem CID | 119222839 |
| Molecular Formula | C19H22FNO6 |
| Molecular Weight | 379.38 g/mol |
| Exact Mass | 379.14 |
| IUPAC Name | 5-[[[4-fluoro-3-(2-methoxyethoxymethyl)benzoyl]-methylamino]methyl]-2-methylfuran-3-carboxylic acid |
| SMILES | COCCOCc1cc(C(=O)N(C)Cc2cc(C(=O)O)c(C)o2)ccc1F |
| InChI | InChI=1S/C19H22FNO6/c1-12-16(19(23)24)9-15(27-12)10-21(2)18(22)13-4-5-17(20)14(8-13)11-26-7-6-25-3/h4-5,8-9H,6-7,10-11H2,1-3H3,(H,23,24) |
| InChIKey | XYZFJFBRIIPQDE-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 89.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.38 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|