C18H30ClFN2O3 — CID 119658828
N-(3-amino-4-methylpentyl)-4-fluoro-3-(2-methoxyethoxymethyl)-N-methylbenzamide;hydrochloride (PubChem CID 119658828) has the molecular formula C18H30ClFN2O3 and a molecular weight of 376.90 g/mol. Its IUPAC name is N-(3-amino-4-methylpentyl)-4-fluoro-3-(2-methoxyethoxymethyl)-N-methylbenzamide;hydrochloride.
| Compound Name | N-(3-amino-4-methylpentyl)-4-fluoro-3-(2-methoxyethoxymethyl)-N-methylbenzamide;hydrochloride |
|---|---|
| PubChem CID | 119658828 |
| Molecular Formula | C18H30ClFN2O3 |
| Molecular Weight | 376.90 g/mol |
| Exact Mass | 376.19 |
| IUPAC Name | N-(3-amino-4-methylpentyl)-4-fluoro-3-(2-methoxyethoxymethyl)-N-methylbenzamide;hydrochloride |
| SMILES | COCCOCc1cc(C(=O)N(C)CCC(N)C(C)C)ccc1F.Cl |
| InChI | InChI=1S/C18H29FN2O3.ClH/c1-13(2)17(20)7-8-21(3)18(22)14-5-6-16(19)15(11-14)12-24-10-9-23-4;/h5-6,11,13,17H,7-10,12,20H2,1-4H3;1H |
| InChIKey | ADEJZDRWFUBGLH-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 64.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.90 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|