C20H28N2O4 — CID 119207661
3-[[1-(2-methoxyethyl)-2,3-dimethylindole-5-carbonyl]-propan-2-ylamino]propanoic acid (PubChem CID 119207661) has the molecular formula C20H28N2O4 and a molecular weight of 360.45 g/mol. Its IUPAC name is 3-[[1-(2-methoxyethyl)-2,3-dimethylindole-5-carbonyl]-propan-2-ylamino]propanoic acid.
| Compound Name | 3-[[1-(2-methoxyethyl)-2,3-dimethylindole-5-carbonyl]-propan-2-ylamino]propanoic acid |
|---|---|
| PubChem CID | 119207661 |
| Molecular Formula | C20H28N2O4 |
| Molecular Weight | 360.45 g/mol |
| Exact Mass | 360.20 |
| IUPAC Name | 3-[[1-(2-methoxyethyl)-2,3-dimethylindole-5-carbonyl]-propan-2-ylamino]propanoic acid |
| SMILES | COCCn1c(C)c(C)c2cc(C(=O)N(CCC(=O)O)C(C)C)ccc21 |
| InChI | InChI=1S/C20H28N2O4/c1-13(2)21(9-8-19(23)24)20(25)16-6-7-18-17(12-16)14(3)15(4)22(18)10-11-26-5/h6-7,12-13H,8-11H2,1-5H3,(H,23,24) |
| InChIKey | SBYYCHGTJFJYHU-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 71.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.45 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|