C23H24N2O4 — CID 120691158
1-[1-(2-methoxyethyl)-2,3-dimethylindole-5-carbonyl]-2,3-dihydroindole-3-carboxylic acid (PubChem CID 120691158) has the molecular formula C23H24N2O4 and a molecular weight of 392.46 g/mol. Its IUPAC name is 1-[1-(2-methoxyethyl)-2,3-dimethylindole-5-carbonyl]-2,3-dihydroindole-3-carboxylic acid.
| Compound Name | 1-[1-(2-methoxyethyl)-2,3-dimethylindole-5-carbonyl]-2,3-dihydroindole-3-carboxylic acid |
|---|---|
| PubChem CID | 120691158 |
| Molecular Formula | C23H24N2O4 |
| Molecular Weight | 392.46 g/mol |
| Exact Mass | 392.17 |
| IUPAC Name | 1-[1-(2-methoxyethyl)-2,3-dimethylindole-5-carbonyl]-2,3-dihydroindole-3-carboxylic acid |
| SMILES | COCCn1c(C)c(C)c2cc(C(=O)N3CC(C(=O)O)c4ccccc43)ccc21 |
| InChI | InChI=1S/C23H24N2O4/c1-14-15(2)24(10-11-29-3)21-9-8-16(12-18(14)21)22(26)25-13-19(23(27)28)17-6-4-5-7-20(17)25/h4-9,12,19H,10-11,13H2,1-3H3,(H,27,28) |
| InChIKey | LXCQSZAJHYCMHJ-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 71.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.46 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|