C20H28N2O4 — CID 119194363
(2S,3S)-2-[[1-(2-methoxyethyl)-2,3-dimethylindole-5-carbonyl]amino]-3-methylpentanoic acid (PubChem CID 119194363) has the molecular formula C20H28N2O4 and a molecular weight of 360.45 g/mol. Its IUPAC name is (2S,3S)-2-[[1-(2-methoxyethyl)-2,3-dimethylindole-5-carbonyl]amino]-3-methylpentanoic acid.
| Compound Name | (2S,3S)-2-[[1-(2-methoxyethyl)-2,3-dimethylindole-5-carbonyl]amino]-3-methylpentanoic acid |
|---|---|
| PubChem CID | 119194363 |
| Molecular Formula | C20H28N2O4 |
| Molecular Weight | 360.45 g/mol |
| Exact Mass | 360.20 |
| IUPAC Name | (2S,3S)-2-[[1-(2-methoxyethyl)-2,3-dimethylindole-5-carbonyl]amino]-3-methylpentanoic acid |
| SMILES | CC[C@H](C)[C@H](NC(=O)c1ccc2c(c1)c(C)c(C)n2CCOC)C(=O)O |
| InChI | InChI=1S/C20H28N2O4/c1-6-12(2)18(20(24)25)21-19(23)15-7-8-17-16(11-15)13(3)14(4)22(17)9-10-26-5/h7-8,11-12,18H,6,9-10H2,1-5H3,(H,21,23)(H,24,25)/t12-,18-/m0/s1 |
| InChIKey | RJPLGLOAPYGNIS-SGTLLEGYSA-N |
| XLogP | 3.13 |
| TPSA | 80.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.45 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|