C23H30N4O3 — CID 99791335
[4-[(R)-hydroxy(1H-imidazol-2-yl)methyl]piperidin-1-yl]-[1-(2-methoxyethyl)-2,3-dimethylindol-5-yl]methanone (PubChem CID 99791335) has the molecular formula C23H30N4O3 and a molecular weight of 410.52 g/mol. Its IUPAC name is [4-[(R)-hydroxy(1H-imidazol-2-yl)methyl]piperidin-1-yl]-[1-(2-methoxyethyl)-2,3-dimethylindol-5-yl]methanone.
| Compound Name | [4-[(R)-hydroxy(1H-imidazol-2-yl)methyl]piperidin-1-yl]-[1-(2-methoxyethyl)-2,3-dimethylindol-5-yl]methanone |
|---|---|
| PubChem CID | 99791335 |
| Molecular Formula | C23H30N4O3 |
| Molecular Weight | 410.52 g/mol |
| Exact Mass | 410.23 |
| IUPAC Name | [4-[(R)-hydroxy(1H-imidazol-2-yl)methyl]piperidin-1-yl]-[1-(2-methoxyethyl)-2,3-dimethylindol-5-yl]methanone |
| SMILES | COCCn1c(C)c(C)c2cc(C(=O)N3CCC([C@@H](O)c4ncc[nH]4)CC3)ccc21 |
| InChI | InChI=1S/C23H30N4O3/c1-15-16(2)27(12-13-30-3)20-5-4-18(14-19(15)20)23(29)26-10-6-17(7-11-26)21(28)22-24-8-9-25-22/h4-5,8-9,14,17,21,28H,6-7,10-13H2,1-3H3,(H,24,25)/t21-/m1/s1 |
| InChIKey | NZZGCRKWGKNCRH-OAQYLSRUSA-N |
| XLogP | 3.21 |
| TPSA | 83.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.52 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|