C17H21NO3 — CID 65162686
2,3-dimethyl-1-[2-(oxolan-2-yl)ethyl]indole-5-carboxylic acid (PubChem CID 65162686) has the molecular formula C17H21NO3 and a molecular weight of 287.36 g/mol. Its IUPAC name is 2,3-dimethyl-1-[2-(oxolan-2-yl)ethyl]indole-5-carboxylic acid.
| Compound Name | 2,3-dimethyl-1-[2-(oxolan-2-yl)ethyl]indole-5-carboxylic acid |
|---|---|
| PubChem CID | 65162686 |
| Molecular Formula | C17H21NO3 |
| Molecular Weight | 287.36 g/mol |
| Exact Mass | 287.15 |
| IUPAC Name | 2,3-dimethyl-1-[2-(oxolan-2-yl)ethyl]indole-5-carboxylic acid |
| SMILES | Cc1c(C)n(CCC2CCCO2)c2ccc(C(=O)O)cc12 |
| InChI | InChI=1S/C17H21NO3/c1-11-12(2)18(8-7-14-4-3-9-21-14)16-6-5-13(17(19)20)10-15(11)16/h5-6,10,14H,3-4,7-9H2,1-2H3,(H,19,20) |
| InChIKey | ADBXWWNEZGRNBP-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 51.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.36 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|