C18H24N2O3 — CID 86714375
2-(oxolan-2-ylmethyl)-1-pentan-3-ylbenzimidazole-5-carboxylic acid (PubChem CID 86714375) has the molecular formula C18H24N2O3 and a molecular weight of 316.40 g/mol. Its IUPAC name is 2-(oxolan-2-ylmethyl)-1-pentan-3-ylbenzimidazole-5-carboxylic acid.
| Compound Name | 2-(oxolan-2-ylmethyl)-1-pentan-3-ylbenzimidazole-5-carboxylic acid |
|---|---|
| PubChem CID | 86714375 |
| Molecular Formula | C18H24N2O3 |
| Molecular Weight | 316.40 g/mol |
| Exact Mass | 316.18 |
| IUPAC Name | 2-(oxolan-2-ylmethyl)-1-pentan-3-ylbenzimidazole-5-carboxylic acid |
| SMILES | CCC(CC)n1c(CC2CCCO2)nc2cc(C(=O)O)ccc21 |
| InChI | InChI=1S/C18H24N2O3/c1-3-13(4-2)20-16-8-7-12(18(21)22)10-15(16)19-17(20)11-14-6-5-9-23-14/h7-8,10,13-14H,3-6,9,11H2,1-2H3,(H,21,22) |
| InChIKey | VJWVMHASFZOSDO-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.40 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |