C25H39N3O2 — CID 90087668
2-(cyclopentylmethyl)-N-(1-hydroxyhexan-2-yl)-1-pentan-3-ylbenzimidazole-5-carboxamide (PubChem CID 90087668) has the molecular formula C25H39N3O2 and a molecular weight of 413.61 g/mol. Its IUPAC name is 2-(cyclopentylmethyl)-N-(1-hydroxyhexan-2-yl)-1-pentan-3-ylbenzimidazole-5-carboxamide.
| Compound Name | 2-(cyclopentylmethyl)-N-(1-hydroxyhexan-2-yl)-1-pentan-3-ylbenzimidazole-5-carboxamide |
|---|---|
| PubChem CID | 90087668 |
| Molecular Formula | C25H39N3O2 |
| Molecular Weight | 413.61 g/mol |
| Exact Mass | 413.30 |
| IUPAC Name | 2-(cyclopentylmethyl)-N-(1-hydroxyhexan-2-yl)-1-pentan-3-ylbenzimidazole-5-carboxamide |
| SMILES | CCCCC(CO)NC(=O)c1ccc2c(c1)nc(CC1CCCC1)n2C(CC)CC |
| InChI | InChI=1S/C25H39N3O2/c1-4-7-12-20(17-29)26-25(30)19-13-14-23-22(16-19)27-24(15-18-10-8-9-11-18)28(23)21(5-2)6-3/h13-14,16,18,20-21,29H,4-12,15,17H2,1-3H3,(H,26,30) |
| InChIKey | WKAGJBYBUXNQPQ-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.61 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |