C29H30FN3O — CID 19291085
(1-benzyl-2,3-dimethylindol-5-yl)-[4-[(3-fluorophenyl)methyl]piperazin-1-yl]methanone (PubChem CID 19291085) has the molecular formula C29H30FN3O and a molecular weight of 455.58 g/mol. Its IUPAC name is (1-benzyl-2,3-dimethylindol-5-yl)-[4-[(3-fluorophenyl)methyl]piperazin-1-yl]methanone.
| Compound Name | (1-benzyl-2,3-dimethylindol-5-yl)-[4-[(3-fluorophenyl)methyl]piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 19291085 |
| Molecular Formula | C29H30FN3O |
| Molecular Weight | 455.58 g/mol |
| Exact Mass | 455.24 |
| IUPAC Name | (1-benzyl-2,3-dimethylindol-5-yl)-[4-[(3-fluorophenyl)methyl]piperazin-1-yl]methanone |
| SMILES | Cc1c(C)n(Cc2ccccc2)c2ccc(C(=O)N3CCN(Cc4cccc(F)c4)CC3)cc12 |
| InChI | InChI=1S/C29H30FN3O/c1-21-22(2)33(20-23-7-4-3-5-8-23)28-12-11-25(18-27(21)28)29(34)32-15-13-31(14-16-32)19-24-9-6-10-26(30)17-24/h3-12,17-18H,13-16,19-20H2,1-2H3 |
| InChIKey | BECSYOGVPQBTPK-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 28.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.58 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|